C15H17NO — CID 132549662
4-[deuterio(phenyl)methoxy]-N,N-dimethylaniline (PubChem CID 132549662) has the molecular formula C15H17NO and a molecular weight of 228.31 g/mol. Its IUPAC name is 4-[deuterio(phenyl)methoxy]-N,N-dimethylaniline.
| Compound Name | 4-[deuterio(phenyl)methoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 132549662 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-[deuterio(phenyl)methoxy]-N,N-dimethylaniline |
| SMILES | [2H]C(Oc1ccc(N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c1-16(2)14-8-10-15(11-9-14)17-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3/i12D |
| InChIKey | DFXQXCWSSGHJBG-UQBWLURTSA-N |
| XLogP | 3.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|