C20H35N5O4 — CID 19869522
1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylurea (PubChem CID 19869522) has the molecular formula C20H35N5O4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylurea.
| Compound Name | 1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 19869522 |
| Molecular Formula | C20H35N5O4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylurea |
| SMILES | CC(C)N(CCOc1ccc([N+](=O)[O-])cc1)C(=O)N(CCN(C)C)CCN(C)C |
| InChI | InChI=1S/C20H35N5O4/c1-17(2)24(15-16-29-19-9-7-18(8-10-19)25(27)28)20(26)23(13-11-21(3)4)14-12-22(5)6/h7-10,17H,11-16H2,1-6H3 |
| InChIKey | BTZYRHQEHDSEMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|