C21H35N7O3 — CID 18637463
2-cyano-1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylguanidine (PubChem CID 18637463) has the molecular formula C21H35N7O3 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-cyano-1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylguanidine.
| Compound Name | 2-cyano-1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 18637463 |
| Molecular Formula | C21H35N7O3 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 2-cyano-1,1-bis[2-(dimethylamino)ethyl]-3-[2-(4-nitrophenoxy)ethyl]-3-propan-2-ylguanidine |
| SMILES | CC(C)N(CCOc1ccc([N+](=O)[O-])cc1)/C(=N/C#N)N(CCN(C)C)CCN(C)C |
| InChI | InChI=1S/C21H35N7O3/c1-18(2)27(15-16-31-20-9-7-19(8-10-20)28(29)30)21(23-17-22)26(13-11-24(3)4)14-12-25(5)6/h7-10,18H,11-16H2,1-6H3/b23-21+ |
| InChIKey | VCAVMGBHICXRMW-XTQSDGFTSA-N |
| XLogP | 1.95 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|