C20H28N2O7S — CID 55725920
ethyl 2-[2-methoxyethyl-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]acetate (PubChem CID 55725920) has the molecular formula C20H28N2O7S and a molecular weight of 440.52 g/mol. Its IUPAC name is ethyl 2-[2-methoxyethyl-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]acetate.
| Compound Name | ethyl 2-[2-methoxyethyl-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 55725920 |
| Molecular Formula | C20H28N2O7S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | ethyl 2-[2-methoxyethyl-[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H28N2O7S/c1-3-29-20(24)16-21(10-13-27-2)19(23)9-6-17-4-7-18(8-5-17)30(25,26)22-11-14-28-15-12-22/h4-9H,3,10-16H2,1-2H3/b9-6+ |
| InChIKey | ZSQCDOGJPKIPPY-RMKNXTFCSA-N |
| XLogP | 0.76 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|