C19H22N4O4S — CID 55531051
(E)-N,N-bis(2-cyanoethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 55531051) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is (E)-N,N-bis(2-cyanoethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-cyanoethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55531051 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (E)-N,N-bis(2-cyanoethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | N#CCCN(CCC#N)C(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c20-9-1-11-22(12-2-10-21)19(24)8-5-17-3-6-18(7-4-17)28(25,26)23-13-15-27-16-14-23/h3-8H,1-2,11-16H2/b8-5+ |
| InChIKey | IQWHTFIZQSIXQR-VMPITWQZSA-N |
| XLogP | 1.38 |
| TPSA | 114.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|