C25H28F2N2O4S — CID 72687398
N-cyclopentyl-N-[(2,6-difluorophenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 72687398) has the molecular formula C25H28F2N2O4S and a molecular weight of 490.57 g/mol. Its IUPAC name is N-cyclopentyl-N-[(2,6-difluorophenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | N-cyclopentyl-N-[(2,6-difluorophenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72687398 |
| Molecular Formula | C25H28F2N2O4S |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-cyclopentyl-N-[(2,6-difluorophenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)N(Cc1c(F)cccc1F)C1CCCC1 |
| InChI | InChI=1S/C25H28F2N2O4S/c26-23-6-3-7-24(27)22(23)18-29(20-4-1-2-5-20)25(30)13-10-19-8-11-21(12-9-19)34(31,32)28-14-16-33-17-15-28/h3,6-13,20H,1-2,4-5,14-18H2 |
| InChIKey | JLNVBSDNKXJZCO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|