C22H32N2O3S — CID 55334511
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-cyclohexyl-N-methylprop-2-enamide (PubChem CID 55334511) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-cyclohexyl-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-cyclohexyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55334511 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-cyclohexyl-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32N2O3S/c1-23(20-9-5-4-6-10-20)22(25)16-13-19-11-14-21(15-12-19)28(26,27)24-17-7-2-3-8-18-24/h11-16,20H,2-10,17-18H2,1H3/b16-13+ |
| InChIKey | HJXVQJYQFCSYTJ-DTQAZKPQSA-N |
| XLogP | 4.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|