C22H27N3O3S — CID 9479737
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N'-methyl-N'-phenylprop-2-enehydrazide (PubChem CID 9479737) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N'-methyl-N'-phenylprop-2-enehydrazide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N'-methyl-N'-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 9479737 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N'-methyl-N'-phenylprop-2-enehydrazide |
| SMILES | CN(NC(=O)/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-24(20-9-5-4-6-10-20)23-22(26)16-13-19-11-14-21(15-12-19)29(27,28)25-17-7-2-3-8-18-25/h4-6,9-16H,2-3,7-8,17-18H2,1H3,(H,23,26)/b16-13+ |
| InChIKey | OBVLUMCXKVFBAM-DTQAZKPQSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|