C22H25N3O4S — CID 6071604
N'-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]benzohydrazide (PubChem CID 6071604) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N'-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 6071604 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N'-[(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O4S/c26-21(23-24-22(27)19-8-4-3-5-9-19)15-12-18-10-13-20(14-11-18)30(28,29)25-16-6-1-2-7-17-25/h3-5,8-15H,1-2,6-7,16-17H2,(H,23,26)(H,24,27)/b15-12+ |
| InChIKey | BKWDDVQQGUCZHA-NTCAYCPXSA-N |
| XLogP | 2.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|