C20H23N3O4S2 — CID 39754933
N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 39754933) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 39754933 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)s1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-15-8-9-17(28-15)10-11-19(24)21-22-20(25)16-6-5-7-18(14-16)29(26,27)23-12-3-2-4-13-23/h5-11,14H,2-4,12-13H2,1H3,(H,21,24)(H,22,25)/b11-10+ |
| InChIKey | OIWIIXKDNITURS-ZHACJKMWSA-N |
| XLogP | 2.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|