C19H27N3O3S — CID 2692216
N'-(cyclohexylidenemethyl)-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 2692216) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is N'-(cyclohexylidenemethyl)-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-(cyclohexylidenemethyl)-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2692216 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N'-(cyclohexylidenemethyl)-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNC=C1CCCCC1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H27N3O3S/c23-19(21-20-15-16-8-3-1-4-9-16)17-10-7-11-18(14-17)26(24,25)22-12-5-2-6-13-22/h7,10-11,14-15,20H,1-6,8-9,12-13H2,(H,21,23) |
| InChIKey | UEYJDRVAGUWUKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|