C19H18F3N3O5S — CID 35507212
3-pyrrolidin-1-ylsulfonyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide (PubChem CID 35507212) has the molecular formula C19H18F3N3O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylsulfonyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide.
| Compound Name | 3-pyrrolidin-1-ylsulfonyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 35507212 |
| Molecular Formula | C19H18F3N3O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 3-pyrrolidin-1-ylsulfonyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O5S/c20-19(21,22)30-15-8-6-13(7-9-15)17(26)23-24-18(27)14-4-3-5-16(12-14)31(28,29)25-10-1-2-11-25/h3-9,12H,1-2,10-11H2,(H,23,26)(H,24,27) |
| InChIKey | RHRCHMBRCHSCMZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|