C20H20N4O4S — CID 9208011
N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)-1H-indole-2-carbohydrazide (PubChem CID 9208011) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)-1H-indole-2-carbohydrazide.
| Compound Name | N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 9208011 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc2ccccc2[nH]1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H20N4O4S/c25-19(22-23-20(26)18-13-14-6-1-2-9-17(14)21-18)15-7-5-8-16(12-15)29(27,28)24-10-3-4-11-24/h1-2,5-9,12-13,21H,3-4,10-11H2,(H,22,25)(H,23,26) |
| InChIKey | BRXJIEOHABASOG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|