C20H20FN3O4S — CID 9093836
N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 9093836) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 9093836 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(/C=C/c1cccc(F)c1)NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H20FN3O4S/c21-17-7-3-5-15(13-17)9-10-19(25)22-23-20(26)16-6-4-8-18(14-16)29(27,28)24-11-1-2-12-24/h3-10,13-14H,1-2,11-12H2,(H,22,25)(H,23,26)/b10-9+ |
| InChIKey | NLHPQKURLMLAMO-MDZDMXLPSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|