C19H27N2O4S- — CID 57371835
N-cycloheptyl-N-(4-piperidin-1-ylsulfonylphenyl)carbamate (PubChem CID 57371835) has the molecular formula C19H27N2O4S- and a molecular weight of 379.50 g/mol. Its IUPAC name is N-cycloheptyl-N-(4-piperidin-1-ylsulfonylphenyl)carbamate.
| Compound Name | N-cycloheptyl-N-(4-piperidin-1-ylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 57371835 |
| Molecular Formula | C19H27N2O4S- |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-cycloheptyl-N-(4-piperidin-1-ylsulfonylphenyl)carbamate |
| SMILES | O=C([O-])N(c1ccc(S(=O)(=O)N2CCCCC2)cc1)C1CCCCCC1 |
| InChI | InChI=1S/C19H28N2O4S/c22-19(23)21(16-8-4-1-2-5-9-16)17-10-12-18(13-11-17)26(24,25)20-14-6-3-7-15-20/h10-13,16H,1-9,14-15H2,(H,22,23)/p-1 |
| InChIKey | NSWUZVLRELVFCI-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |