C19H23NO6S — CID 5122490
(2-oxocyclohexyl) 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 5122490) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is (2-oxocyclohexyl) 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | (2-oxocyclohexyl) 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5122490 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2-oxocyclohexyl) 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)OC1CCCCC1=O |
| InChI | InChI=1S/C19H23NO6S/c21-17-3-1-2-4-18(17)26-19(22)10-7-15-5-8-16(9-6-15)27(23,24)20-11-13-25-14-12-20/h5-10,18H,1-4,11-14H2 |
| InChIKey | JSBAVZNJKVFYPY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|