C17H20FNO6S — CID 3294241
(2-oxocyclohexyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 3294241) has the molecular formula C17H20FNO6S and a molecular weight of 385.41 g/mol. Its IUPAC name is (2-oxocyclohexyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-oxocyclohexyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3294241 |
| Molecular Formula | C17H20FNO6S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2-oxocyclohexyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OC1CCCCC1=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C17H20FNO6S/c18-14-6-5-12(26(22,23)19-7-9-24-10-8-19)11-13(14)17(21)25-16-4-2-1-3-15(16)20/h5-6,11,16H,1-4,7-10H2 |
| InChIKey | UUMLIMDBFUQJQM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |