C19H25NO5S — CID 4044670
(2-oxocyclohexyl) 2-methyl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 4044670) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2-oxocyclohexyl) 2-methyl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxocyclohexyl) 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4044670 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2-oxocyclohexyl) 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)OC1CCCCC1=O |
| InChI | InChI=1S/C19H25NO5S/c1-14-9-10-15(26(23,24)20-11-5-2-6-12-20)13-16(14)19(22)25-18-8-4-3-7-17(18)21/h9-10,13,18H,2-8,11-12H2,1H3 |
| InChIKey | VRZAPVSKWSKRHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |