C18H27NO5S — CID 55356811
2-propan-2-yloxyethyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 55356811) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-propan-2-yloxyethyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55356811 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)OCCOC(C)C |
| InChI | InChI=1S/C18H27NO5S/c1-14(2)23-11-12-24-18(20)17-13-16(8-7-15(17)3)25(21,22)19-9-5-4-6-10-19/h7-8,13-14H,4-6,9-12H2,1-3H3 |
| InChIKey | FDUDKIPOOGRVEB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|