C17H20ClNO5S — CID 7902202
[(1R)-2-oxocyclohexyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 7902202) has the molecular formula C17H20ClNO5S and a molecular weight of 385.87 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7902202 |
| Molecular Formula | C17H20ClNO5S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(O[C@@H]1CCCCC1=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C17H20ClNO5S/c18-14-8-7-12(25(22,23)19-9-3-4-10-19)11-13(14)17(21)24-16-6-2-1-5-15(16)20/h7-8,11,16H,1-6,9-10H2/t16-/m1/s1 |
| InChIKey | AELGJRVLNSERAG-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |