About [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate
[(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 7878762) has the molecular formula C15H18ClNO5S
and a molecular weight of 359.83 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| PubChem CID | 7878762 |
| Molecular Formula | C15H18ClNO5S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)O[C@H]2CCCCC2=O)c1 |
| InChI | InChI=1S/C15H18ClNO5S/c1-17(2)23(20,21)10-7-8-12(16)11(9-10)15(19)22-14-6-4-3-5-13(14)18/h7-9,14H,3-6H2,1-2H3/t14-/m0/s1 |
| InChIKey | IHKGGDLBLKRBCZ-AWEZNQCLSA-N |
| XLogP | 2.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate?
The IUPAC name of [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (CID 7878762) is [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate?
The canonical SMILES for [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate is CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)O[C@H]2CCCCC2=O)c1.
What is the InChIKey of [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate?
The InChIKey is IHKGGDLBLKRBCZ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H18ClNO5S/c1-17(2)23(20,21)10-7-8-12(16)11(9-10)15(19)22-14-6-4-3-5-13(14)18/h7-9,14H,3-6H2,1-2H3/t14-/m0/s1.
What are the key properties of [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate?
[(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate has a molecular weight of 359.83 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-oxocyclohexyl] 2-chloro-5-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 7878762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).