C18H23NO5S — CID 2676935
[(1S)-2-oxocyclopentyl] 2-methyl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2676935) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is [(1S)-2-oxocyclopentyl] 2-methyl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(1S)-2-oxocyclopentyl] 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2676935 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(1S)-2-oxocyclopentyl] 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)O[C@H]1CCCC1=O |
| InChI | InChI=1S/C18H23NO5S/c1-13-8-9-14(25(22,23)19-10-3-2-4-11-19)12-15(13)18(21)24-17-7-5-6-16(17)20/h8-9,12,17H,2-7,10-11H2,1H3/t17-/m0/s1 |
| InChIKey | GJRQUCYOJJNOTJ-KRWDZBQOSA-N |
| XLogP | 2.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |