C19H24FN3O5S — CID 32651804
cyclopropyl-[4-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]methanone (PubChem CID 32651804) has the molecular formula C19H24FN3O5S and a molecular weight of 425.48 g/mol. Its IUPAC name is cyclopropyl-[4-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32651804 |
| Molecular Formula | C19H24FN3O5S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | cyclopropyl-[4-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCOCC2)ccc1F)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C19H24FN3O5S/c20-17-4-3-15(29(26,27)23-9-11-28-12-10-23)13-16(17)19(25)22-7-5-21(6-8-22)18(24)14-1-2-14/h3-4,13-14H,1-2,5-12H2 |
| InChIKey | WSOHORZOMIXVJM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |