C16H21FN2O5S — CID 55612788
(2-fluoro-5-morpholin-4-ylsulfonylphenyl)-(3-methylmorpholin-4-yl)methanone (PubChem CID 55612788) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is (2-fluoro-5-morpholin-4-ylsulfonylphenyl)-(3-methylmorpholin-4-yl)methanone.
| Compound Name | (2-fluoro-5-morpholin-4-ylsulfonylphenyl)-(3-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 55612788 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2-fluoro-5-morpholin-4-ylsulfonylphenyl)-(3-methylmorpholin-4-yl)methanone |
| SMILES | CC1COCCN1C(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C16H21FN2O5S/c1-12-11-24-9-6-19(12)16(20)14-10-13(2-3-15(14)17)25(21,22)18-4-7-23-8-5-18/h2-3,10,12H,4-9,11H2,1H3 |
| InChIKey | KNJOAOFPASTVSW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |