C20H27FN2O6S — CID 3893462
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 3893462) has the molecular formula C20H27FN2O6S and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3893462 |
| Molecular Formula | C20H27FN2O6S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC1CCCCC1NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C20H27FN2O6S/c1-14-4-2-3-5-18(14)22-19(24)13-29-20(25)16-12-15(6-7-17(16)21)30(26,27)23-8-10-28-11-9-23/h6-7,12,14,18H,2-5,8-11,13H2,1H3,(H,22,24) |
| InChIKey | OXRXOSIVWTZWLX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |