C20H30N2O8S — CID 55726301
ethyl 2-[2-methoxyethyl-[2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetyl]amino]acetate (PubChem CID 55726301) has the molecular formula C20H30N2O8S and a molecular weight of 458.53 g/mol. Its IUPAC name is ethyl 2-[2-methoxyethyl-[2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetyl]amino]acetate.
| Compound Name | ethyl 2-[2-methoxyethyl-[2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55726301 |
| Molecular Formula | C20H30N2O8S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl 2-[2-methoxyethyl-[2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)Cc1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H30N2O8S/c1-4-30-20(24)15-21(7-10-27-2)19(23)14-16-5-6-17(28-3)18(13-16)31(25,26)22-8-11-29-12-9-22/h5-6,13H,4,7-12,14-15H2,1-3H3 |
| InChIKey | ULCBOVLTECHAAV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |