C20H28N2O6S — CID 9340017
[2-[butyl(methyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 9340017) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-[butyl(methyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-[butyl(methyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9340017 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-[butyl(methyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | CCCCN(C)C(=O)COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H28N2O6S/c1-3-4-11-21(2)19(23)16-28-20(24)10-7-17-5-8-18(9-6-17)29(25,26)22-12-14-27-15-13-22/h5-10H,3-4,11-16H2,1-2H3/b10-7+ |
| InChIKey | OIJCGNWDJPJTDB-JXMROGBWSA-N |
| XLogP | 1.52 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|