C23H25N3O5S2 — CID 55545420
(E)-N-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 55545420) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55545420 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COCCN(C(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-30-15-14-26(23-24-20-4-2-3-5-21(20)32-23)22(27)11-8-18-6-9-19(10-7-18)33(28,29)25-12-16-31-17-13-25/h2-11H,12-17H2,1H3/b11-8+ |
| InChIKey | LEUMSWOCPRIYGH-DHZHZOJOSA-N |
| XLogP | 3.01 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|