C22H23N3O4S2 — CID 16559872
(E)-N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 16559872) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16559872 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-N-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-2-25(22-23-19-5-3-4-6-20(19)30-22)21(26)12-9-17-7-10-18(11-8-17)31(27,28)24-13-15-29-16-14-24/h3-12H,2,13-16H2,1H3/b12-9+ |
| InChIKey | GYAGFAVSDOXNAN-FMIVXFBMSA-N |
| XLogP | 3.38 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|