C20H24N4O3 — CID 133332510
2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-5-nitrobenzamide (PubChem CID 133332510) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-5-nitrobenzamide.
| Compound Name | 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 133332510 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(N)=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4O3/c1-15-9-10-22(11-12-23(15)14-16-5-3-2-4-6-16)19-8-7-17(24(26)27)13-18(19)20(21)25/h2-8,13,15H,9-12,14H2,1H3,(H2,21,25) |
| InChIKey | QGKWQUNDBIVYOO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|