C13H18N4O3 — CID 63267846
2-[3-(methylaminomethyl)pyrrolidin-1-yl]-5-nitrobenzamide (PubChem CID 63267846) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-5-nitrobenzamide.
| Compound Name | 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 63267846 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-5-nitrobenzamide |
| SMILES | CNCC1CCN(c2ccc([N+](=O)[O-])cc2C(N)=O)C1 |
| InChI | InChI=1S/C13H18N4O3/c1-15-7-9-4-5-16(8-9)12-3-2-10(17(19)20)6-11(12)13(14)18/h2-3,6,9,15H,4-5,7-8H2,1H3,(H2,14,18) |
| InChIKey | RQIFKKHHKZEKGM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|