C14H21N3S — CID 131226911
2-(4-benzyl-3-methylpiperazin-1-yl)ethanethioamide (PubChem CID 131226911) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-(4-benzyl-3-methylpiperazin-1-yl)ethanethioamide.
| Compound Name | 2-(4-benzyl-3-methylpiperazin-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 131226911 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(4-benzyl-3-methylpiperazin-1-yl)ethanethioamide |
| SMILES | CC1CN(CC(N)=S)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C14H21N3S/c1-12-9-16(11-14(15)18)7-8-17(12)10-13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3,(H2,15,18) |
| InChIKey | VAIUIOUNHIRBRO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|