About 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole
2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 67987635) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| PubChem CID | 67987635 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | C[C@H]1CN(C)CCN1Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H19N3O/c1-11-9-16(2)7-8-17(11)10-14-15-12-5-3-4-6-13(12)18-14/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | AUFHJNFYMBSRGG-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The IUPAC name of 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole (CID 67987635) is 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The canonical SMILES for 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole is C[C@H]1CN(C)CCN1Cc1nc2ccccc2o1.
What is the InChIKey of 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The InChIKey is AUFHJNFYMBSRGG-NSHDSACASA-N. The full InChI is InChI=1S/C14H19N3O/c1-11-9-16(2)7-8-17(11)10-14-15-12-5-3-4-6-13(12)18-14/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1.
What are the key properties of 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole?
2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole has a molecular weight of 245.33 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole is sourced from PubChem (CID 67987635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).