C14H19N3O — CID 67987635
2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 67987635) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole.
| Compound Name | 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 67987635 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | C[C@H]1CN(C)CCN1Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H19N3O/c1-11-9-16(2)7-8-17(11)10-14-15-12-5-3-4-6-13(12)18-14/h3-6,11H,7-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | AUFHJNFYMBSRGG-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |