About (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol
(2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol (PubChem CID 95978173) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol |
| PubChem CID | 95978173 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(CCCc2nc3ccccc3o2)C[C@@H]1C |
| InChI | InChI=1S/C18H27N3O2/c1-14-12-20(10-11-21(14)13-15(2)22)9-5-8-18-19-16-6-3-4-7-17(16)23-18/h3-4,6-7,14-15,22H,5,8-13H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | RLBLIDKWVLZHFO-LSDHHAIUSA-N |
| XLogP | 2.15 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol?
The IUPAC name of (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol (CID 95978173) is (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol.
What is the SMILES notation for (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol?
The canonical SMILES for (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol is C[C@@H](O)CN1CCN(CCCc2nc3ccccc3o2)C[C@@H]1C.
What is the InChIKey of (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol?
The InChIKey is RLBLIDKWVLZHFO-LSDHHAIUSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-14-12-20(10-11-21(14)13-15(2)22)9-5-8-18-19-16-6-3-4-7-17(16)23-18/h3-4,6-7,14-15,22H,5,8-13H2,1-2H3/t14-,15+/m0/s1.
What are the key properties of (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol?
(2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol has a molecular weight of 317.43 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(2S)-4-[3-(1,3-benzoxazol-2-yl)propyl]-2-methylpiperazin-1-yl]propan-2-ol is sourced from PubChem (CID 95978173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).