C17H25N3O2 — CID 95309136
(2R)-1-[4-[3-(1,3-benzoxazol-2-yl)propyl]piperazin-1-yl]propan-2-ol (PubChem CID 95309136) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R)-1-[4-[3-(1,3-benzoxazol-2-yl)propyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-[3-(1,3-benzoxazol-2-yl)propyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95309136 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2R)-1-[4-[3-(1,3-benzoxazol-2-yl)propyl]piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(CCCc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-14(21)13-20-11-9-19(10-12-20)8-4-7-17-18-15-5-2-3-6-16(15)22-17/h2-3,5-6,14,21H,4,7-13H2,1H3/t14-/m1/s1 |
| InChIKey | ACOAWIUWGFJRDW-CQSZACIVSA-N |
| XLogP | 1.76 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |