C16H22N2O — CID 22989639
2-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzoxazole (PubChem CID 22989639) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzoxazole.
| Compound Name | 2-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 22989639 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzoxazole |
| SMILES | CC1CCN(CCCc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C16H22N2O/c1-13-8-11-18(12-9-13)10-4-7-16-17-14-5-2-3-6-15(14)19-16/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | SCJGHPNPJZFSBH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |