C27H43NO5Si — CID 102392839
benzyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-methyl-3,7-dioxoheptyl]piperidine-1-carboxylate (PubChem CID 102392839) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is benzyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-methyl-3,7-dioxoheptyl]piperidine-1-carboxylate.
| Compound Name | benzyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-methyl-3,7-dioxoheptyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102392839 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | benzyl (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(5R)-5-methyl-3,7-dioxoheptyl]piperidine-1-carboxylate |
| SMILES | C[C@H](CC=O)CC(=O)CC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C27H43NO5Si/c1-21(14-15-29)16-24(30)13-12-23-17-25(33-34(5,6)27(2,3)4)19-28(18-23)26(31)32-20-22-10-8-7-9-11-22/h7-11,15,21,23,25H,12-14,16-20H2,1-6H3/t21-,23+,25+/m1/s1 |
| InChIKey | HAKGQMVJTZRCQD-VTZPFEBOSA-N |
| XLogP | 6.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|