C17H32N2O3Si — CID 70373954
[tert-butyl(dimethyl)silyl] 2-(1-methylpyrrolidin-2-yl)-N-prop-2-enoxycarbonylethanimidate (PubChem CID 70373954) has the molecular formula C17H32N2O3Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(1-methylpyrrolidin-2-yl)-N-prop-2-enoxycarbonylethanimidate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(1-methylpyrrolidin-2-yl)-N-prop-2-enoxycarbonylethanimidate |
|---|---|
| PubChem CID | 70373954 |
| Molecular Formula | C17H32N2O3Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(1-methylpyrrolidin-2-yl)-N-prop-2-enoxycarbonylethanimidate |
| SMILES | C=CCOC(=O)N=C(CC1CCCN1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O3Si/c1-8-12-21-16(20)18-15(13-14-10-9-11-19(14)5)22-23(6,7)17(2,3)4/h8,14H,1,9-13H2,2-7H3 |
| InChIKey | UGFHIFDNNFDASB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|