About methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol
methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol (PubChem CID 91224158) has the molecular formula C7H16ClNO3S
and a molecular weight of 229.73 g/mol. Its IUPAC name is methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol |
| PubChem CID | 91224158 |
| Molecular Formula | C7H16ClNO3S |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CN1CCC[C@H]1CO.CS(=O)(=O)Cl |
| InChI | InChI=1S/C6H13NO.CH3ClO2S/c1-7-4-2-3-6(7)5-8;1-5(2,3)4/h6,8H,2-5H2,1H3;1H3/t6-;/m0./s1 |
| InChIKey | LZTMUWYXDPIBRB-RGMNGODLSA-N |
| XLogP | 0.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The IUPAC name of methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol (CID 91224158) is methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol.
What is the SMILES notation for methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The canonical SMILES for methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol is CN1CCC[C@H]1CO.CS(=O)(=O)Cl.
What is the InChIKey of methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The InChIKey is LZTMUWYXDPIBRB-RGMNGODLSA-N. The full InChI is InChI=1S/C6H13NO.CH3ClO2S/c1-7-4-2-3-6(7)5-8;1-5(2,3)4/h6,8H,2-5H2,1H3;1H3/t6-;/m0./s1.
What are the key properties of methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol?
methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol has a molecular weight of 229.73 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonyl chloride;[(2S)-1-methylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 91224158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).