About cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen
cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen (PubChem CID 143951282) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen.
Molecular Properties
| Compound Name | cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen |
| PubChem CID | 143951282 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen |
| SMILES | C1CCCCC1.CN1CCC[C@H]1CO.[H][H] |
| InChI | InChI=1S/C6H13NO.C6H12.H2/c1-7-4-2-3-6(7)5-8;1-2-4-6-5-3-1;/h6,8H,2-5H2,1H3;1-6H2;1H/t6-;;/m0../s1 |
| InChIKey | YJVYKZTWEYIKCN-ILKKLZGPSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen?
The IUPAC name of cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen (CID 143951282) is cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen.
What is the SMILES notation for cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen?
The canonical SMILES for cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen is C1CCCCC1.CN1CCC[C@H]1CO.[H][H].
What is the InChIKey of cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen?
The InChIKey is YJVYKZTWEYIKCN-ILKKLZGPSA-N. The full InChI is InChI=1S/C6H13NO.C6H12.H2/c1-7-4-2-3-6(7)5-8;1-2-4-6-5-3-1;/h6,8H,2-5H2,1H3;1-6H2;1H/t6-;;/m0../s1.
What are the key properties of cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen?
cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen has a molecular weight of 201.35 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;[(2S)-1-methylpyrrolidin-2-yl]methanol;molecular hydrogen is sourced from PubChem (CID 143951282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).