C8H18N2O — CID 118068301
(1,4-dimethyl-1,4-diazepan-5-yl)methanol (PubChem CID 118068301) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is (1,4-dimethyl-1,4-diazepan-5-yl)methanol.
| Compound Name | (1,4-dimethyl-1,4-diazepan-5-yl)methanol |
|---|---|
| PubChem CID | 118068301 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (1,4-dimethyl-1,4-diazepan-5-yl)methanol |
| SMILES | CN1CCC(CO)N(C)CC1 |
| InChI | InChI=1S/C8H18N2O/c1-9-4-3-8(7-11)10(2)6-5-9/h8,11H,3-7H2,1-2H3 |
| InChIKey | WMKRUBGEXLTMQV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |