C11H25NO3S — CID 175583536
2-butyl-1-methylpiperidine;methanesulfonic acid (PubChem CID 175583536) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-butyl-1-methylpiperidine;methanesulfonic acid.
| Compound Name | 2-butyl-1-methylpiperidine;methanesulfonic acid |
|---|---|
| PubChem CID | 175583536 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-butyl-1-methylpiperidine;methanesulfonic acid |
| SMILES | CCCCC1CCCCN1C.CS(=O)(=O)O |
| InChI | InChI=1S/C10H21N.CH4O3S/c1-3-4-7-10-8-5-6-9-11(10)2;1-5(2,3)4/h10H,3-9H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | LVYPUJGIRJUFHD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|