C13H26F3NO3S — CID 174876415
2-butyl-1-methylpyrrolidine;fluoroform;prop-2-ene-1-sulfonic acid (PubChem CID 174876415) has the molecular formula C13H26F3NO3S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-butyl-1-methylpyrrolidine;fluoroform;prop-2-ene-1-sulfonic acid.
| Compound Name | 2-butyl-1-methylpyrrolidine;fluoroform;prop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 174876415 |
| Molecular Formula | C13H26F3NO3S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-butyl-1-methylpyrrolidine;fluoroform;prop-2-ene-1-sulfonic acid |
| SMILES | C=CCS(=O)(=O)O.CCCCC1CCCN1C.FC(F)F |
| InChI | InChI=1S/C9H19N.C3H6O3S.CHF3/c1-3-4-6-9-7-5-8-10(9)2;1-2-3-7(4,5)6;2-1(3)4/h9H,3-8H2,1-2H3;2H,1,3H2,(H,4,5,6);1H |
| InChIKey | SKRGRWZHMZHSKT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|