C13H24F2N2 — CID 169170818
N-(2,2-difluoroethyl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]but-3-en-1-amine (PubChem CID 169170818) has the molecular formula C13H24F2N2 and a molecular weight of 246.34 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]but-3-en-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 169170818 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]but-3-en-1-amine |
| SMILES | C=CCCN(CC[C@H]1CCCN1C)CC(F)F |
| InChI | InChI=1S/C13H24F2N2/c1-3-4-9-17(11-13(14)15)10-7-12-6-5-8-16(12)2/h3,12-13H,1,4-11H2,2H3/t12-/m1/s1 |
| InChIKey | NETHOWGOZKLQCN-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|