C13H26F3NO3S — CID 175849542
1,2-dibutylpyrrolidine;trifluoromethanesulfonic acid (PubChem CID 175849542) has the molecular formula C13H26F3NO3S and a molecular weight of 333.42 g/mol. Its IUPAC name is 1,2-dibutylpyrrolidine;trifluoromethanesulfonic acid.
| Compound Name | 1,2-dibutylpyrrolidine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175849542 |
| Molecular Formula | C13H26F3NO3S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1,2-dibutylpyrrolidine;trifluoromethanesulfonic acid |
| SMILES | CCCCC1CCCN1CCCC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H25N.CHF3O3S/c1-3-5-8-12-9-7-11-13(12)10-6-4-2;2-1(3,4)8(5,6)7/h12H,3-11H2,1-2H3;(H,5,6,7) |
| InChIKey | PBIMUIAUMGXVJU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|