C27H38N2O5 — CID 122404815
[(2S)-2-[[(2S)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate (PubChem CID 122404815) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate.
| Compound Name | [(2S)-2-[[(2S)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate |
|---|---|
| PubChem CID | 122404815 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | [(2S)-2-[[(2S)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](NC(=O)C(CC=C)CC(=O)N1CCC[C@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O5/c1-3-5-6-10-16-26(32)34-20-24(21-13-8-7-9-14-21)28-27(33)22(12-4-2)18-25(31)29-17-11-15-23(29)19-30/h3-4,7-9,13-14,22-24,30H,1-2,5-6,10-12,15-20H2,(H,28,33)/t22?,23-,24+/m0/s1 |
| InChIKey | DQOVBPAECJEAGQ-YDUIRMPASA-N |
| XLogP | 3.70 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|