C24H40N2O5 — CID 6606284
[(2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate (PubChem CID 6606284) has the molecular formula C24H40N2O5 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606284 |
| Molecular Formula | C24H40N2O5 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoyl]amino]-3-methylbutyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](NC(=O)[C@H](CC=C)CC(=O)N1CCC[C@H]1CO)C(C)C |
| InChI | InChI=1S/C24H40N2O5/c1-5-7-8-9-13-23(29)31-17-21(18(3)4)25-24(30)19(11-6-2)15-22(28)26-14-10-12-20(26)16-27/h5-6,18-21,27H,1-2,7-17H2,3-4H3,(H,25,30)/t19-,20+,21-/m1/s1 |
| InChIKey | AMUAXECKFASMEW-QHAWAJNXSA-N |
| XLogP | 2.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|