C29H42N2O6 — CID 5163739
[2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] hept-6-enoate (PubChem CID 5163739) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] hept-6-enoate.
| Compound Name | [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] hept-6-enoate |
|---|---|
| PubChem CID | 5163739 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | [2-[2-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]pent-4-enoylamino]-3-phenylmethoxypropyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OCC(COCc1ccccc1)NC(=O)C(CC=C)CC(=O)N1CCCC1CO |
| InChI | InChI=1S/C29H42N2O6/c1-3-5-6-10-16-28(34)37-22-25(21-36-20-23-13-8-7-9-14-23)30-29(35)24(12-4-2)18-27(33)31-17-11-15-26(31)19-32/h3-4,7-9,13-14,24-26,32H,1-2,5-6,10-12,15-22H2,(H,30,35) |
| InChIKey | SUVAGBNKDRNSLH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|