C32H40N2O5 — CID 6606479
[(2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate (PubChem CID 6606479) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate.
| Compound Name | [(2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate |
|---|---|
| PubChem CID | 6606479 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(2S)-2-[[(2R)-2-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoyl]amino]-2-phenylethyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC[C@@H](NC(=O)C(CC=C)CC(=O)N1Cc2ccccc2C[C@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C32H40N2O5/c1-3-5-6-10-18-31(37)39-23-29(24-14-8-7-9-15-24)33-32(38)26(13-4-2)20-30(36)34-21-27-17-12-11-16-25(27)19-28(34)22-35/h3-4,7-9,11-12,14-17,26,28-29,35H,1-2,5-6,10,13,18-23H2,(H,33,38)/t26?,28-,29+/m0/s1 |
| InChIKey | RSTKKHAKMYDSFH-GXRAEGJDSA-N |
| XLogP | 4.66 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|