C39H46N2O5 — CID 4188977
[2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate (PubChem CID 4188977) has the molecular formula C39H46N2O5 and a molecular weight of 622.81 g/mol. Its IUPAC name is [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate.
| Compound Name | [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 4188977 |
| Molecular Formula | C39H46N2O5 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | [2-[2-[2-[3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]pent-4-enoylamino]-2-phenylethyl] 2-benzylhept-6-enoate |
| SMILES | C=CCCCC(Cc1ccccc1)C(=O)OCC(NC(=O)C(CC=C)CC(=O)N1Cc2ccccc2CC1CO)c1ccccc1 |
| InChI | InChI=1S/C39H46N2O5/c1-3-5-8-21-33(23-29-16-9-6-10-17-29)39(45)46-28-36(30-18-11-7-12-19-30)40-38(44)32(15-4-2)25-37(43)41-26-34-22-14-13-20-31(34)24-35(41)27-42/h3-4,6-7,9-14,16-20,22,32-33,35-36,42H,1-2,5,8,15,21,23-28H2,(H,40,44) |
| InChIKey | NVJAJLYOFOVYGO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|